C29H24ClN3O3S — CID 17317115
2-chloro-N-[4-[(2,2-diphenylacetyl)carbamothioylamino]-2-methoxyphenyl]benzamide (PubChem CID 17317115) has the molecular formula C29H24ClN3O3S and a molecular weight of 530.05 g/mol. Its IUPAC name is 2-chloro-N-[4-[(2,2-diphenylacetyl)carbamothioylamino]-2-methoxyphenyl]benzamide.
| Compound Name | 2-chloro-N-[4-[(2,2-diphenylacetyl)carbamothioylamino]-2-methoxyphenyl]benzamide |
|---|---|
| PubChem CID | 17317115 |
| Molecular Formula | C29H24ClN3O3S |
| Molecular Weight | 530.05 g/mol |
| Exact Mass | 529.12 |
| IUPAC Name | 2-chloro-N-[4-[(2,2-diphenylacetyl)carbamothioylamino]-2-methoxyphenyl]benzamide |
| SMILES | COc1cc(NC(=S)NC(=O)C(c2ccccc2)c2ccccc2)ccc1NC(=O)c1ccccc1Cl |
| InChI | InChI=1S/C29H24ClN3O3S/c1-36-25-18-21(16-17-24(25)32-27(34)22-14-8-9-15-23(22)30)31-29(37)33-28(35)26(19-10-4-2-5-11-19)20-12-6-3-7-13-20/h2-18,26H,1H3,(H,32,34)(H2,31,33,35,37) |
| InChIKey | MXGUVWFAJUATPA-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.05 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|