C12H15N3O3S — CID 43316147
N-(2-amino-2-sulfanylideneethyl)-N'-(4-ethoxyphenyl)oxamide (PubChem CID 43316147) has the molecular formula C12H15N3O3S and a molecular weight of 281.34 g/mol. Its IUPAC name is N-(2-amino-2-sulfanylideneethyl)-N'-(4-ethoxyphenyl)oxamide.
| Compound Name | N-(2-amino-2-sulfanylideneethyl)-N'-(4-ethoxyphenyl)oxamide |
|---|---|
| PubChem CID | 43316147 |
| Molecular Formula | C12H15N3O3S |
| Molecular Weight | 281.34 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | N-(2-amino-2-sulfanylideneethyl)-N'-(4-ethoxyphenyl)oxamide |
| SMILES | CCOc1ccc(NC(=O)C(=O)NCC(N)=S)cc1 |
| InChI | InChI=1S/C12H15N3O3S/c1-2-18-9-5-3-8(4-6-9)15-12(17)11(16)14-7-10(13)19/h3-6H,2,7H2,1H3,(H2,13,19)(H,14,16)(H,15,17) |
| InChIKey | IJBUBHSQGFMGQP-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.34 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|