C11H12ClN3O3 — CID 108513978
N'-(4-carbamoylphenyl)-N-(2-chloroethyl)oxamide (PubChem CID 108513978) has the molecular formula C11H12ClN3O3 and a molecular weight of 269.69 g/mol. Its IUPAC name is N'-(4-carbamoylphenyl)-N-(2-chloroethyl)oxamide.
| Compound Name | N'-(4-carbamoylphenyl)-N-(2-chloroethyl)oxamide |
|---|---|
| PubChem CID | 108513978 |
| Molecular Formula | C11H12ClN3O3 |
| Molecular Weight | 269.69 g/mol |
| Exact Mass | 269.06 |
| IUPAC Name | N'-(4-carbamoylphenyl)-N-(2-chloroethyl)oxamide |
| SMILES | NC(=O)c1ccc(NC(=O)C(=O)NCCCl)cc1 |
| InChI | InChI=1S/C11H12ClN3O3/c12-5-6-14-10(17)11(18)15-8-3-1-7(2-4-8)9(13)16/h1-4H,5-6H2,(H2,13,16)(H,14,17)(H,15,18) |
| InChIKey | WXFDQZYKGJXSKE-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.69 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|