C19H21F3N4O3S — CID 60500983
2-[4-(4-sulfamoylphenyl)piperazin-1-yl]-N-[3-(trifluoromethyl)phenyl]acetamide (PubChem CID 60500983) has the molecular formula C19H21F3N4O3S and a molecular weight of 442.46 g/mol. Its IUPAC name is 2-[4-(4-sulfamoylphenyl)piperazin-1-yl]-N-[3-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-[4-(4-sulfamoylphenyl)piperazin-1-yl]-N-[3-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 60500983 |
| Molecular Formula | C19H21F3N4O3S |
| Molecular Weight | 442.46 g/mol |
| Exact Mass | 442.13 |
| IUPAC Name | 2-[4-(4-sulfamoylphenyl)piperazin-1-yl]-N-[3-(trifluoromethyl)phenyl]acetamide |
| SMILES | NS(=O)(=O)c1ccc(N2CCN(CC(=O)Nc3cccc(C(F)(F)F)c3)CC2)cc1 |
| InChI | InChI=1S/C19H21F3N4O3S/c20-19(21,22)14-2-1-3-15(12-14)24-18(27)13-25-8-10-26(11-9-25)16-4-6-17(7-5-16)30(23,28)29/h1-7,12H,8-11,13H2,(H,24,27)(H2,23,28,29) |
| InChIKey | NJDITUIKBGUEMY-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 95.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.46 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |