C17H18F3N3S — CID 160954925
1-(3,4,5,6-tetramethyl-2-pyridinyl)-3-[3-(trifluoromethyl)phenyl]thiourea (PubChem CID 160954925) has the molecular formula C17H18F3N3S and a molecular weight of 353.41 g/mol. Its IUPAC name is 1-(3,4,5,6-tetramethyl-2-pyridinyl)-3-[3-(trifluoromethyl)phenyl]thiourea.
| Compound Name | 1-(3,4,5,6-tetramethyl-2-pyridinyl)-3-[3-(trifluoromethyl)phenyl]thiourea |
|---|---|
| PubChem CID | 160954925 |
| Molecular Formula | C17H18F3N3S |
| Molecular Weight | 353.41 g/mol |
| Exact Mass | 353.12 |
| IUPAC Name | 1-(3,4,5,6-tetramethyl-2-pyridinyl)-3-[3-(trifluoromethyl)phenyl]thiourea |
| SMILES | Cc1nc(NC(=S)Nc2cccc(C(F)(F)F)c2)c(C)c(C)c1C |
| InChI | InChI=1S/C17H18F3N3S/c1-9-10(2)12(4)21-15(11(9)3)23-16(24)22-14-7-5-6-13(8-14)17(18,19)20/h5-8H,1-4H3,(H2,21,22,23,24) |
| InChIKey | SWGKACOTRPQSNP-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.41 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|