C15H8ClN7 — CID 168608704
2-[4-[(6-chloropyridazin-3-yl)amino]anilino]ethene-1,1,2-tricarbonitrile (PubChem CID 168608704) has the molecular formula C15H8ClN7 and a molecular weight of 321.73 g/mol. Its IUPAC name is 2-[4-[(6-chloropyridazin-3-yl)amino]anilino]ethene-1,1,2-tricarbonitrile.
| Compound Name | 2-[4-[(6-chloropyridazin-3-yl)amino]anilino]ethene-1,1,2-tricarbonitrile |
|---|---|
| PubChem CID | 168608704 |
| Molecular Formula | C15H8ClN7 |
| Molecular Weight | 321.73 g/mol |
| Exact Mass | 321.05 |
| IUPAC Name | 2-[4-[(6-chloropyridazin-3-yl)amino]anilino]ethene-1,1,2-tricarbonitrile |
| SMILES | N#CC(C#N)=C(C#N)Nc1ccc(Nc2ccc(Cl)nn2)cc1 |
| InChI | InChI=1S/C15H8ClN7/c16-14-5-6-15(23-22-14)21-12-3-1-11(2-4-12)20-13(9-19)10(7-17)8-18/h1-6,20H,(H,21,23) |
| InChIKey | LRSWXXFWVCQZIX-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 121.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.73 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|