C14H7N5S — CID 168609826
2-[4-(1,3-thiazol-4-yl)anilino]ethene-1,1,2-tricarbonitrile (PubChem CID 168609826) has the molecular formula C14H7N5S and a molecular weight of 277.31 g/mol. Its IUPAC name is 2-[4-(1,3-thiazol-4-yl)anilino]ethene-1,1,2-tricarbonitrile.
| Compound Name | 2-[4-(1,3-thiazol-4-yl)anilino]ethene-1,1,2-tricarbonitrile |
|---|---|
| PubChem CID | 168609826 |
| Molecular Formula | C14H7N5S |
| Molecular Weight | 277.31 g/mol |
| Exact Mass | 277.04 |
| IUPAC Name | 2-[4-(1,3-thiazol-4-yl)anilino]ethene-1,1,2-tricarbonitrile |
| SMILES | N#CC(C#N)=C(C#N)Nc1ccc(-c2cscn2)cc1 |
| InChI | InChI=1S/C14H7N5S/c15-5-11(6-16)13(7-17)19-12-3-1-10(2-4-12)14-8-20-9-18-14/h1-4,8-9,19H |
| InChIKey | ZRBGVNGIKLLHJI-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 96.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.31 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|