C16H13N5O — CID 168609578
2-[4-(4,4-dimethyl-5H-1,3-oxazol-2-yl)anilino]ethene-1,1,2-tricarbonitrile (PubChem CID 168609578) has the molecular formula C16H13N5O and a molecular weight of 291.31 g/mol. Its IUPAC name is 2-[4-(4,4-dimethyl-5H-1,3-oxazol-2-yl)anilino]ethene-1,1,2-tricarbonitrile.
| Compound Name | 2-[4-(4,4-dimethyl-5H-1,3-oxazol-2-yl)anilino]ethene-1,1,2-tricarbonitrile |
|---|---|
| PubChem CID | 168609578 |
| Molecular Formula | C16H13N5O |
| Molecular Weight | 291.31 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | 2-[4-(4,4-dimethyl-5H-1,3-oxazol-2-yl)anilino]ethene-1,1,2-tricarbonitrile |
| SMILES | CC1(C)COC(c2ccc(NC(C#N)=C(C#N)C#N)cc2)=N1 |
| InChI | InChI=1S/C16H13N5O/c1-16(2)10-22-15(21-16)11-3-5-13(6-4-11)20-14(9-19)12(7-17)8-18/h3-6,20H,10H2,1-2H3 |
| InChIKey | FOQQHHGRHNQUEC-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 104.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.31 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|