C20H12N4O3 — CID 168608259
2-[4-(2,3-dihydro-1,4-benzodioxine-6-carbonyl)anilino]ethene-1,1,2-tricarbonitrile (PubChem CID 168608259) has the molecular formula C20H12N4O3 and a molecular weight of 356.34 g/mol. Its IUPAC name is 2-[4-(2,3-dihydro-1,4-benzodioxine-6-carbonyl)anilino]ethene-1,1,2-tricarbonitrile.
| Compound Name | 2-[4-(2,3-dihydro-1,4-benzodioxine-6-carbonyl)anilino]ethene-1,1,2-tricarbonitrile |
|---|---|
| PubChem CID | 168608259 |
| Molecular Formula | C20H12N4O3 |
| Molecular Weight | 356.34 g/mol |
| Exact Mass | 356.09 |
| IUPAC Name | 2-[4-(2,3-dihydro-1,4-benzodioxine-6-carbonyl)anilino]ethene-1,1,2-tricarbonitrile |
| SMILES | N#CC(C#N)=C(C#N)Nc1ccc(C(=O)c2ccc3c(c2)OCCO3)cc1 |
| InChI | InChI=1S/C20H12N4O3/c21-10-15(11-22)17(12-23)24-16-4-1-13(2-5-16)20(25)14-3-6-18-19(9-14)27-8-7-26-18/h1-6,9,24H,7-8H2 |
| InChIKey | QBEBKNOWBRWGSN-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 118.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.34 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|