C11H7AsN4O3 — CID 168610750
[4-(1,2,2-tricyanoethenylamino)phenyl]arsonic acid (PubChem CID 168610750) has the molecular formula C11H7AsN4O3 and a molecular weight of 318.12 g/mol. Its IUPAC name is [4-(1,2,2-tricyanoethenylamino)phenyl]arsonic acid.
| Compound Name | [4-(1,2,2-tricyanoethenylamino)phenyl]arsonic acid |
|---|---|
| PubChem CID | 168610750 |
| Molecular Formula | C11H7AsN4O3 |
| Molecular Weight | 318.12 g/mol |
| Exact Mass | 317.97 |
| IUPAC Name | [4-(1,2,2-tricyanoethenylamino)phenyl]arsonic acid |
| SMILES | N#CC(C#N)=C(C#N)Nc1ccc([As](=O)(O)O)cc1 |
| InChI | InChI=1S/C11H7AsN4O3/c13-5-8(6-14)11(7-15)16-10-3-1-9(2-4-10)12(17,18)19/h1-4,16H,(H2,17,18,19) |
| InChIKey | LQPIYBOPVSBTBL-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 140.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.12 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|