C17H11BN4O3 — CID 168607521
[4-[4-(1,2,2-tricyanoethenylamino)phenoxy]phenyl]boronic acid (PubChem CID 168607521) has the molecular formula C17H11BN4O3 and a molecular weight of 330.11 g/mol. Its IUPAC name is [4-[4-(1,2,2-tricyanoethenylamino)phenoxy]phenyl]boronic acid.
| Compound Name | [4-[4-(1,2,2-tricyanoethenylamino)phenoxy]phenyl]boronic acid |
|---|---|
| PubChem CID | 168607521 |
| Molecular Formula | C17H11BN4O3 |
| Molecular Weight | 330.11 g/mol |
| Exact Mass | 330.09 |
| IUPAC Name | [4-[4-(1,2,2-tricyanoethenylamino)phenoxy]phenyl]boronic acid |
| SMILES | N#CC(C#N)=C(C#N)Nc1ccc(Oc2ccc(B(O)O)cc2)cc1 |
| InChI | InChI=1S/C17H11BN4O3/c19-9-12(10-20)17(11-21)22-14-3-7-16(8-4-14)25-15-5-1-13(2-6-15)18(23)24/h1-8,22-24H |
| InChIKey | VGEBFPLUBLBLOH-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 133.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.11 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|