C13H8N8 — CID 168609780
2-[4-(5-methyltetrazol-2-yl)anilino]ethene-1,1,2-tricarbonitrile (PubChem CID 168609780) has the molecular formula C13H8N8 and a molecular weight of 276.26 g/mol. Its IUPAC name is 2-[4-(5-methyltetrazol-2-yl)anilino]ethene-1,1,2-tricarbonitrile.
| Compound Name | 2-[4-(5-methyltetrazol-2-yl)anilino]ethene-1,1,2-tricarbonitrile |
|---|---|
| PubChem CID | 168609780 |
| Molecular Formula | C13H8N8 |
| Molecular Weight | 276.26 g/mol |
| Exact Mass | 276.09 |
| IUPAC Name | 2-[4-(5-methyltetrazol-2-yl)anilino]ethene-1,1,2-tricarbonitrile |
| SMILES | Cc1nnn(-c2ccc(NC(C#N)=C(C#N)C#N)cc2)n1 |
| InChI | InChI=1S/C13H8N8/c1-9-18-20-21(19-9)12-4-2-11(3-5-12)17-13(8-16)10(6-14)7-15/h2-5,17H,1H3 |
| InChIKey | OMJRYZLUKYSFKK-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 127.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.26 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|