C15H9N7O — CID 168608349
1-[4-(1,2,2-tricyanoethenylamino)phenyl]pyrazole-3-carboxamide (PubChem CID 168608349) has the molecular formula C15H9N7O and a molecular weight of 303.29 g/mol. Its IUPAC name is 1-[4-(1,2,2-tricyanoethenylamino)phenyl]pyrazole-3-carboxamide.
| Compound Name | 1-[4-(1,2,2-tricyanoethenylamino)phenyl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 168608349 |
| Molecular Formula | C15H9N7O |
| Molecular Weight | 303.29 g/mol |
| Exact Mass | 303.09 |
| IUPAC Name | 1-[4-(1,2,2-tricyanoethenylamino)phenyl]pyrazole-3-carboxamide |
| SMILES | N#CC(C#N)=C(C#N)Nc1ccc(-n2ccc(C(N)=O)n2)cc1 |
| InChI | InChI=1S/C15H9N7O/c16-7-10(8-17)14(9-18)20-11-1-3-12(4-2-11)22-6-5-13(21-22)15(19)23/h1-6,20H,(H2,19,23) |
| InChIKey | CZNZZECTHWHOFE-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 144.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.29 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|