C19H25N5O4S — CID 56585894
1-[4-[[2-[(4-methylcyclohexyl)sulfamoyl]acetyl]amino]phenyl]pyrazole-3-carboxamide (PubChem CID 56585894) has the molecular formula C19H25N5O4S and a molecular weight of 419.51 g/mol. Its IUPAC name is 1-[4-[[2-[(4-methylcyclohexyl)sulfamoyl]acetyl]amino]phenyl]pyrazole-3-carboxamide.
| Compound Name | 1-[4-[[2-[(4-methylcyclohexyl)sulfamoyl]acetyl]amino]phenyl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 56585894 |
| Molecular Formula | C19H25N5O4S |
| Molecular Weight | 419.51 g/mol |
| Exact Mass | 419.16 |
| IUPAC Name | 1-[4-[[2-[(4-methylcyclohexyl)sulfamoyl]acetyl]amino]phenyl]pyrazole-3-carboxamide |
| SMILES | CC1CCC(NS(=O)(=O)CC(=O)Nc2ccc(-n3ccc(C(N)=O)n3)cc2)CC1 |
| InChI | InChI=1S/C19H25N5O4S/c1-13-2-4-15(5-3-13)23-29(27,28)12-18(25)21-14-6-8-16(9-7-14)24-11-10-17(22-24)19(20)26/h6-11,13,15,23H,2-5,12H2,1H3,(H2,20,26)(H,21,25) |
| InChIKey | MOKCOYFYTGCYMW-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 136.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.51 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |