C12H14N6O — CID 61260899
2-(cyclopropylamino)-N-[4-(tetrazol-1-yl)phenyl]acetamide (PubChem CID 61260899) has the molecular formula C12H14N6O and a molecular weight of 258.28 g/mol. Its IUPAC name is 2-(cyclopropylamino)-N-[4-(tetrazol-1-yl)phenyl]acetamide.
| Compound Name | 2-(cyclopropylamino)-N-[4-(tetrazol-1-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 61260899 |
| Molecular Formula | C12H14N6O |
| Molecular Weight | 258.28 g/mol |
| Exact Mass | 258.12 |
| IUPAC Name | 2-(cyclopropylamino)-N-[4-(tetrazol-1-yl)phenyl]acetamide |
| SMILES | O=C(CNC1CC1)Nc1ccc(-n2cnnn2)cc1 |
| InChI | InChI=1S/C12H14N6O/c19-12(7-13-9-1-2-9)15-10-3-5-11(6-4-10)18-8-14-16-17-18/h3-6,8-9,13H,1-2,7H2,(H,15,19) |
| InChIKey | PSAOYTDDHMTWCI-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.28 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |