C13H16N6O — CID 61261084
2-(cyclopropylmethylamino)-N-[4-(tetrazol-1-yl)phenyl]acetamide (PubChem CID 61261084) has the molecular formula C13H16N6O and a molecular weight of 272.31 g/mol. Its IUPAC name is 2-(cyclopropylmethylamino)-N-[4-(tetrazol-1-yl)phenyl]acetamide.
| Compound Name | 2-(cyclopropylmethylamino)-N-[4-(tetrazol-1-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 61261084 |
| Molecular Formula | C13H16N6O |
| Molecular Weight | 272.31 g/mol |
| Exact Mass | 272.14 |
| IUPAC Name | 2-(cyclopropylmethylamino)-N-[4-(tetrazol-1-yl)phenyl]acetamide |
| SMILES | O=C(CNCC1CC1)Nc1ccc(-n2cnnn2)cc1 |
| InChI | InChI=1S/C13H16N6O/c20-13(8-14-7-10-1-2-10)16-11-3-5-12(6-4-11)19-9-15-17-18-19/h3-6,9-10,14H,1-2,7-8H2,(H,16,20) |
| InChIKey | WHEKHARFQWXKSN-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.31 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |