C15H14BrClN2S — CID 65499374
4-(4-bromo-2,6-dimethylanilino)-2-chlorobenzenecarbothioamide (PubChem CID 65499374) has the molecular formula C15H14BrClN2S and a molecular weight of 369.72 g/mol. Its IUPAC name is 4-(4-bromo-2,6-dimethylanilino)-2-chlorobenzenecarbothioamide.
| Compound Name | 4-(4-bromo-2,6-dimethylanilino)-2-chlorobenzenecarbothioamide |
|---|---|
| PubChem CID | 65499374 |
| Molecular Formula | C15H14BrClN2S |
| Molecular Weight | 369.72 g/mol |
| Exact Mass | 367.97 |
| IUPAC Name | 4-(4-bromo-2,6-dimethylanilino)-2-chlorobenzenecarbothioamide |
| SMILES | Cc1cc(Br)cc(C)c1Nc1ccc(C(N)=S)c(Cl)c1 |
| InChI | InChI=1S/C15H14BrClN2S/c1-8-5-10(16)6-9(2)14(8)19-11-3-4-12(15(18)20)13(17)7-11/h3-7,19H,1-2H3,(H2,18,20) |
| InChIKey | IFWKJOZCKGTGEZ-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.72 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|