C22H26N4O4 — CID 90564983
3,4,5-triethoxy-N-[6-(2-methylimidazol-1-yl)-3-pyridinyl]benzamide (PubChem CID 90564983) has the molecular formula C22H26N4O4 and a molecular weight of 410.47 g/mol. Its IUPAC name is 3,4,5-triethoxy-N-[6-(2-methylimidazol-1-yl)-3-pyridinyl]benzamide.
| Compound Name | 3,4,5-triethoxy-N-[6-(2-methylimidazol-1-yl)-3-pyridinyl]benzamide |
|---|---|
| PubChem CID | 90564983 |
| Molecular Formula | C22H26N4O4 |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.20 |
| IUPAC Name | 3,4,5-triethoxy-N-[6-(2-methylimidazol-1-yl)-3-pyridinyl]benzamide |
| SMILES | CCOc1cc(C(=O)Nc2ccc(-n3ccnc3C)nc2)cc(OCC)c1OCC |
| InChI | InChI=1S/C22H26N4O4/c1-5-28-18-12-16(13-19(29-6-2)21(18)30-7-3)22(27)25-17-8-9-20(24-14-17)26-11-10-23-15(26)4/h8-14H,5-7H2,1-4H3,(H,25,27) |
| InChIKey | LGGOMVXEPXOYRK-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 87.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |