C20H20FN3O4 — CID 60584920
N-[(3-fluoro-4-imidazol-1-ylphenyl)methyl]-3,4,5-trimethoxybenzamide (PubChem CID 60584920) has the molecular formula C20H20FN3O4 and a molecular weight of 385.40 g/mol. Its IUPAC name is N-[(3-fluoro-4-imidazol-1-ylphenyl)methyl]-3,4,5-trimethoxybenzamide.
| Compound Name | N-[(3-fluoro-4-imidazol-1-ylphenyl)methyl]-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 60584920 |
| Molecular Formula | C20H20FN3O4 |
| Molecular Weight | 385.40 g/mol |
| Exact Mass | 385.14 |
| IUPAC Name | N-[(3-fluoro-4-imidazol-1-ylphenyl)methyl]-3,4,5-trimethoxybenzamide |
| SMILES | COc1cc(C(=O)NCc2ccc(-n3ccnc3)c(F)c2)cc(OC)c1OC |
| InChI | InChI=1S/C20H20FN3O4/c1-26-17-9-14(10-18(27-2)19(17)28-3)20(25)23-11-13-4-5-16(15(21)8-13)24-7-6-22-12-24/h4-10,12H,11H2,1-3H3,(H,23,25) |
| InChIKey | WTXGXYYOVLNLQL-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 74.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.40 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |