C18H17FN4O4S — CID 47799498
N-[(3-fluoro-4-imidazol-1-ylphenyl)methyl]-2-methoxy-5-sulfamoylbenzamide (PubChem CID 47799498) has the molecular formula C18H17FN4O4S and a molecular weight of 404.42 g/mol. Its IUPAC name is N-[(3-fluoro-4-imidazol-1-ylphenyl)methyl]-2-methoxy-5-sulfamoylbenzamide.
| Compound Name | N-[(3-fluoro-4-imidazol-1-ylphenyl)methyl]-2-methoxy-5-sulfamoylbenzamide |
|---|---|
| PubChem CID | 47799498 |
| Molecular Formula | C18H17FN4O4S |
| Molecular Weight | 404.42 g/mol |
| Exact Mass | 404.10 |
| IUPAC Name | N-[(3-fluoro-4-imidazol-1-ylphenyl)methyl]-2-methoxy-5-sulfamoylbenzamide |
| SMILES | COc1ccc(S(N)(=O)=O)cc1C(=O)NCc1ccc(-n2ccnc2)c(F)c1 |
| InChI | InChI=1S/C18H17FN4O4S/c1-27-17-5-3-13(28(20,25)26)9-14(17)18(24)22-10-12-2-4-16(15(19)8-12)23-7-6-21-11-23/h2-9,11H,10H2,1H3,(H,22,24)(H2,20,25,26) |
| InChIKey | ZBWCOYZJOYLDLU-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 116.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.42 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |