C15H21Cl2FN4O — CID 120564989
4-amino-N-[(3-fluoro-4-imidazol-1-ylphenyl)methyl]pentanamide;dihydrochloride (PubChem CID 120564989) has the molecular formula C15H21Cl2FN4O and a molecular weight of 363.26 g/mol. Its IUPAC name is 4-amino-N-[(3-fluoro-4-imidazol-1-ylphenyl)methyl]pentanamide;dihydrochloride.
| Compound Name | 4-amino-N-[(3-fluoro-4-imidazol-1-ylphenyl)methyl]pentanamide;dihydrochloride |
|---|---|
| PubChem CID | 120564989 |
| Molecular Formula | C15H21Cl2FN4O |
| Molecular Weight | 363.26 g/mol |
| Exact Mass | 362.11 |
| IUPAC Name | 4-amino-N-[(3-fluoro-4-imidazol-1-ylphenyl)methyl]pentanamide;dihydrochloride |
| SMILES | CC(N)CCC(=O)NCc1ccc(-n2ccnc2)c(F)c1.Cl.Cl |
| InChI | InChI=1S/C15H19FN4O.2ClH/c1-11(17)2-5-15(21)19-9-12-3-4-14(13(16)8-12)20-7-6-18-10-20;;/h3-4,6-8,10-11H,2,5,9,17H2,1H3,(H,19,21);2*1H |
| InChIKey | IOWONMLCGCPXJD-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.26 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |