C18H16F2N4O — CID 166194769
3-[(3-fluoro-4-imidazol-1-ylphenyl)methyl]-1-(4-fluorophenyl)-1-methylurea (PubChem CID 166194769) has the molecular formula C18H16F2N4O and a molecular weight of 342.35 g/mol. Its IUPAC name is 3-[(3-fluoro-4-imidazol-1-ylphenyl)methyl]-1-(4-fluorophenyl)-1-methylurea.
| Compound Name | 3-[(3-fluoro-4-imidazol-1-ylphenyl)methyl]-1-(4-fluorophenyl)-1-methylurea |
|---|---|
| PubChem CID | 166194769 |
| Molecular Formula | C18H16F2N4O |
| Molecular Weight | 342.35 g/mol |
| Exact Mass | 342.13 |
| IUPAC Name | 3-[(3-fluoro-4-imidazol-1-ylphenyl)methyl]-1-(4-fluorophenyl)-1-methylurea |
| SMILES | CN(C(=O)NCc1ccc(-n2ccnc2)c(F)c1)c1ccc(F)cc1 |
| InChI | InChI=1S/C18H16F2N4O/c1-23(15-5-3-14(19)4-6-15)18(25)22-11-13-2-7-17(16(20)10-13)24-9-8-21-12-24/h2-10,12H,11H2,1H3,(H,22,25) |
| InChIKey | LKZWMMILVXZNFY-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.35 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |