C15H19Cl2FN4O — CID 119863400
N-[(3-fluoro-4-imidazol-1-ylphenyl)methyl]pyrrolidine-3-carboxamide;dihydrochloride (PubChem CID 119863400) has the molecular formula C15H19Cl2FN4O and a molecular weight of 361.25 g/mol. Its IUPAC name is N-[(3-fluoro-4-imidazol-1-ylphenyl)methyl]pyrrolidine-3-carboxamide;dihydrochloride.
| Compound Name | N-[(3-fluoro-4-imidazol-1-ylphenyl)methyl]pyrrolidine-3-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 119863400 |
| Molecular Formula | C15H19Cl2FN4O |
| Molecular Weight | 361.25 g/mol |
| Exact Mass | 360.09 |
| IUPAC Name | N-[(3-fluoro-4-imidazol-1-ylphenyl)methyl]pyrrolidine-3-carboxamide;dihydrochloride |
| SMILES | Cl.Cl.O=C(NCc1ccc(-n2ccnc2)c(F)c1)C1CCNC1 |
| InChI | InChI=1S/C15H17FN4O.2ClH/c16-13-7-11(1-2-14(13)20-6-5-18-10-20)8-19-15(21)12-3-4-17-9-12;;/h1-2,5-7,10,12,17H,3-4,8-9H2,(H,19,21);2*1H |
| InChIKey | VAVFUSKXOHZPHN-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.25 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |