C20H19FN4O3 — CID 47799467
N-[(3-fluoro-4-imidazol-1-ylphenyl)methyl]-1-(furan-2-carbonyl)pyrrolidine-2-carboxamide (PubChem CID 47799467) has the molecular formula C20H19FN4O3 and a molecular weight of 382.40 g/mol. Its IUPAC name is N-[(3-fluoro-4-imidazol-1-ylphenyl)methyl]-1-(furan-2-carbonyl)pyrrolidine-2-carboxamide.
| Compound Name | N-[(3-fluoro-4-imidazol-1-ylphenyl)methyl]-1-(furan-2-carbonyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 47799467 |
| Molecular Formula | C20H19FN4O3 |
| Molecular Weight | 382.40 g/mol |
| Exact Mass | 382.14 |
| IUPAC Name | N-[(3-fluoro-4-imidazol-1-ylphenyl)methyl]-1-(furan-2-carbonyl)pyrrolidine-2-carboxamide |
| SMILES | O=C(NCc1ccc(-n2ccnc2)c(F)c1)C1CCCN1C(=O)c1ccco1 |
| InChI | InChI=1S/C20H19FN4O3/c21-15-11-14(5-6-16(15)24-9-7-22-13-24)12-23-19(26)17-3-1-8-25(17)20(27)18-4-2-10-28-18/h2,4-7,9-11,13,17H,1,3,8,12H2,(H,23,26) |
| InChIKey | JOOOOFPTICZLJC-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 80.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.40 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |