C15H20FN3O — CID 68873168
N-[(3-fluoro-4-piperazin-1-ylphenyl)methyl]cyclopropanecarboxamide (PubChem CID 68873168) has the molecular formula C15H20FN3O and a molecular weight of 277.34 g/mol. Its IUPAC name is N-[(3-fluoro-4-piperazin-1-ylphenyl)methyl]cyclopropanecarboxamide.
| Compound Name | N-[(3-fluoro-4-piperazin-1-ylphenyl)methyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 68873168 |
| Molecular Formula | C15H20FN3O |
| Molecular Weight | 277.34 g/mol |
| Exact Mass | 277.16 |
| IUPAC Name | N-[(3-fluoro-4-piperazin-1-ylphenyl)methyl]cyclopropanecarboxamide |
| SMILES | O=C(NCc1ccc(N2CCNCC2)c(F)c1)C1CC1 |
| InChI | InChI=1S/C15H20FN3O/c16-13-9-11(10-18-15(20)12-2-3-12)1-4-14(13)19-7-5-17-6-8-19/h1,4,9,12,17H,2-3,5-8,10H2,(H,18,20) |
| InChIKey | DXMKCBSBFJFCGL-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.34 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |