C21H20FN3O3 — CID 60585064
(E)-3-(2,4-dimethoxyphenyl)-N-[(3-fluoro-4-imidazol-1-ylphenyl)methyl]prop-2-enamide (PubChem CID 60585064) has the molecular formula C21H20FN3O3 and a molecular weight of 381.41 g/mol. Its IUPAC name is (E)-3-(2,4-dimethoxyphenyl)-N-[(3-fluoro-4-imidazol-1-ylphenyl)methyl]prop-2-enamide.
| Compound Name | (E)-3-(2,4-dimethoxyphenyl)-N-[(3-fluoro-4-imidazol-1-ylphenyl)methyl]prop-2-enamide |
|---|---|
| PubChem CID | 60585064 |
| Molecular Formula | C21H20FN3O3 |
| Molecular Weight | 381.41 g/mol |
| Exact Mass | 381.15 |
| IUPAC Name | (E)-3-(2,4-dimethoxyphenyl)-N-[(3-fluoro-4-imidazol-1-ylphenyl)methyl]prop-2-enamide |
| SMILES | COc1ccc(/C=C/C(=O)NCc2ccc(-n3ccnc3)c(F)c2)c(OC)c1 |
| InChI | InChI=1S/C21H20FN3O3/c1-27-17-6-4-16(20(12-17)28-2)5-8-21(26)24-13-15-3-7-19(18(22)11-15)25-10-9-23-14-25/h3-12,14H,13H2,1-2H3,(H,24,26)/b8-5+ |
| InChIKey | CSSVOSCNQSWSEB-VMPITWQZSA-N |
| XLogP | 3.36 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.41 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|