C21H16FN5O — CID 71885790
N-[(3-fluoro-4-imidazol-1-ylphenyl)methyl]-3-quinoxalin-2-ylprop-2-enamide (PubChem CID 71885790) has the molecular formula C21H16FN5O and a molecular weight of 373.39 g/mol. Its IUPAC name is N-[(3-fluoro-4-imidazol-1-ylphenyl)methyl]-3-quinoxalin-2-ylprop-2-enamide.
| Compound Name | N-[(3-fluoro-4-imidazol-1-ylphenyl)methyl]-3-quinoxalin-2-ylprop-2-enamide |
|---|---|
| PubChem CID | 71885790 |
| Molecular Formula | C21H16FN5O |
| Molecular Weight | 373.39 g/mol |
| Exact Mass | 373.13 |
| IUPAC Name | N-[(3-fluoro-4-imidazol-1-ylphenyl)methyl]-3-quinoxalin-2-ylprop-2-enamide |
| SMILES | O=C(C=Cc1cnc2ccccc2n1)NCc1ccc(-n2ccnc2)c(F)c1 |
| InChI | InChI=1S/C21H16FN5O/c22-17-11-15(5-7-20(17)27-10-9-23-14-27)12-25-21(28)8-6-16-13-24-18-3-1-2-4-19(18)26-16/h1-11,13-14H,12H2,(H,25,28) |
| InChIKey | ABPHEFJUZAUWDE-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.39 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|