C28H30ClN3O3 — CID 59318192
4-[4-[4-[(3-tert-butylphenyl)carbamoyl]-2-chlorophenyl]piperazin-1-yl]benzoic acid (PubChem CID 59318192) has the molecular formula C28H30ClN3O3 and a molecular weight of 492.02 g/mol. Its IUPAC name is 4-[4-[4-[(3-tert-butylphenyl)carbamoyl]-2-chlorophenyl]piperazin-1-yl]benzoic acid.
| Compound Name | 4-[4-[4-[(3-tert-butylphenyl)carbamoyl]-2-chlorophenyl]piperazin-1-yl]benzoic acid |
|---|---|
| PubChem CID | 59318192 |
| Molecular Formula | C28H30ClN3O3 |
| Molecular Weight | 492.02 g/mol |
| Exact Mass | 491.20 |
| IUPAC Name | 4-[4-[4-[(3-tert-butylphenyl)carbamoyl]-2-chlorophenyl]piperazin-1-yl]benzoic acid |
| SMILES | CC(C)(C)c1cccc(NC(=O)c2ccc(N3CCN(c4ccc(C(=O)O)cc4)CC3)c(Cl)c2)c1 |
| InChI | InChI=1S/C28H30ClN3O3/c1-28(2,3)21-5-4-6-22(18-21)30-26(33)20-9-12-25(24(29)17-20)32-15-13-31(14-16-32)23-10-7-19(8-11-23)27(34)35/h4-12,17-18H,13-16H2,1-3H3,(H,30,33)(H,34,35) |
| InChIKey | LNPCGPSDJWFWDQ-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.02 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |