C30H35N3O3 — CID 59318150
ethyl 4-[4-[4-[(3-tert-butylphenyl)carbamoyl]phenyl]piperazin-1-yl]benzoate (PubChem CID 59318150) has the molecular formula C30H35N3O3 and a molecular weight of 485.63 g/mol. Its IUPAC name is ethyl 4-[4-[4-[(3-tert-butylphenyl)carbamoyl]phenyl]piperazin-1-yl]benzoate.
| Compound Name | ethyl 4-[4-[4-[(3-tert-butylphenyl)carbamoyl]phenyl]piperazin-1-yl]benzoate |
|---|---|
| PubChem CID | 59318150 |
| Molecular Formula | C30H35N3O3 |
| Molecular Weight | 485.63 g/mol |
| Exact Mass | 485.27 |
| IUPAC Name | ethyl 4-[4-[4-[(3-tert-butylphenyl)carbamoyl]phenyl]piperazin-1-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(N2CCN(c3ccc(C(=O)Nc4cccc(C(C)(C)C)c4)cc3)CC2)cc1 |
| InChI | InChI=1S/C30H35N3O3/c1-5-36-29(35)23-11-15-27(16-12-23)33-19-17-32(18-20-33)26-13-9-22(10-14-26)28(34)31-25-8-6-7-24(21-25)30(2,3)4/h6-16,21H,5,17-20H2,1-4H3,(H,31,34) |
| InChIKey | BECLSFKYXBKIAI-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.63 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |