C17H17FN4O2 — CID 109230952
N-(4-fluorophenyl)-5-(4-formylpiperazin-1-yl)pyridine-3-carboxamide (PubChem CID 109230952) has the molecular formula C17H17FN4O2 and a molecular weight of 328.35 g/mol. Its IUPAC name is N-(4-fluorophenyl)-5-(4-formylpiperazin-1-yl)pyridine-3-carboxamide.
| Compound Name | N-(4-fluorophenyl)-5-(4-formylpiperazin-1-yl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 109230952 |
| Molecular Formula | C17H17FN4O2 |
| Molecular Weight | 328.35 g/mol |
| Exact Mass | 328.13 |
| IUPAC Name | N-(4-fluorophenyl)-5-(4-formylpiperazin-1-yl)pyridine-3-carboxamide |
| SMILES | O=CN1CCN(c2cncc(C(=O)Nc3ccc(F)cc3)c2)CC1 |
| InChI | InChI=1S/C17H17FN4O2/c18-14-1-3-15(4-2-14)20-17(24)13-9-16(11-19-10-13)22-7-5-21(12-23)6-8-22/h1-4,9-12H,5-8H2,(H,20,24) |
| InChIKey | DCULKIOJAADJKW-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.35 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|