C24H24N4O2 — CID 46489538
N-[4-[(4-piperidin-1-ylphenyl)carbamoyl]phenyl]pyridine-2-carboxamide (PubChem CID 46489538) has the molecular formula C24H24N4O2 and a molecular weight of 400.48 g/mol. Its IUPAC name is N-[4-[(4-piperidin-1-ylphenyl)carbamoyl]phenyl]pyridine-2-carboxamide.
| Compound Name | N-[4-[(4-piperidin-1-ylphenyl)carbamoyl]phenyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 46489538 |
| Molecular Formula | C24H24N4O2 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.19 |
| IUPAC Name | N-[4-[(4-piperidin-1-ylphenyl)carbamoyl]phenyl]pyridine-2-carboxamide |
| SMILES | O=C(Nc1ccc(N2CCCCC2)cc1)c1ccc(NC(=O)c2ccccn2)cc1 |
| InChI | InChI=1S/C24H24N4O2/c29-23(26-20-11-13-21(14-12-20)28-16-4-1-5-17-28)18-7-9-19(10-8-18)27-24(30)22-6-2-3-15-25-22/h2-3,6-15H,1,4-5,16-17H2,(H,26,29)(H,27,30) |
| InChIKey | GHOHQQSLLHKSQG-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|