C14H6Br2Cl2INO3 — CID 43866230
2,4-dichloro-5-[(3,5-dibromo-2-iodobenzoyl)amino]benzoic acid (PubChem CID 43866230) has the molecular formula C14H6Br2Cl2INO3 and a molecular weight of 593.82 g/mol. Its IUPAC name is 2,4-dichloro-5-[(3,5-dibromo-2-iodobenzoyl)amino]benzoic acid.
| Compound Name | 2,4-dichloro-5-[(3,5-dibromo-2-iodobenzoyl)amino]benzoic acid |
|---|---|
| PubChem CID | 43866230 |
| Molecular Formula | C14H6Br2Cl2INO3 |
| Molecular Weight | 593.82 g/mol |
| Exact Mass | 590.71 |
| IUPAC Name | 2,4-dichloro-5-[(3,5-dibromo-2-iodobenzoyl)amino]benzoic acid |
| SMILES | O=C(O)c1cc(NC(=O)c2cc(Br)cc(Br)c2I)c(Cl)cc1Cl |
| InChI | InChI=1S/C14H6Br2Cl2INO3/c15-5-1-7(12(19)8(16)2-5)13(21)20-11-3-6(14(22)23)9(17)4-10(11)18/h1-4H,(H,20,21)(H,22,23) |
| InChIKey | MQIQZWYGHLCAHI-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.82 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|