C13H12BrNOS — CID 33142040
N-(2-bromophenyl)-2,5-dimethylthiophene-3-carboxamide (PubChem CID 33142040) has the molecular formula C13H12BrNOS and a molecular weight of 310.22 g/mol. Its IUPAC name is N-(2-bromophenyl)-2,5-dimethylthiophene-3-carboxamide.
| Compound Name | N-(2-bromophenyl)-2,5-dimethylthiophene-3-carboxamide |
|---|---|
| PubChem CID | 33142040 |
| Molecular Formula | C13H12BrNOS |
| Molecular Weight | 310.22 g/mol |
| Exact Mass | 308.98 |
| IUPAC Name | N-(2-bromophenyl)-2,5-dimethylthiophene-3-carboxamide |
| SMILES | Cc1cc(C(=O)Nc2ccccc2Br)c(C)s1 |
| InChI | InChI=1S/C13H12BrNOS/c1-8-7-10(9(2)17-8)13(16)15-12-6-4-3-5-11(12)14/h3-7H,1-2H3,(H,15,16) |
| InChIKey | LSNMTCJGSMYZOF-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.22 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |