C20H19NOS — CID 9327727
N-(2-benzylphenyl)-2,5-dimethylthiophene-3-carboxamide (PubChem CID 9327727) has the molecular formula C20H19NOS and a molecular weight of 321.45 g/mol. Its IUPAC name is N-(2-benzylphenyl)-2,5-dimethylthiophene-3-carboxamide.
| Compound Name | N-(2-benzylphenyl)-2,5-dimethylthiophene-3-carboxamide |
|---|---|
| PubChem CID | 9327727 |
| Molecular Formula | C20H19NOS |
| Molecular Weight | 321.45 g/mol |
| Exact Mass | 321.12 |
| IUPAC Name | N-(2-benzylphenyl)-2,5-dimethylthiophene-3-carboxamide |
| SMILES | Cc1cc(C(=O)Nc2ccccc2Cc2ccccc2)c(C)s1 |
| InChI | InChI=1S/C20H19NOS/c1-14-12-18(15(2)23-14)20(22)21-19-11-7-6-10-17(19)13-16-8-4-3-5-9-16/h3-12H,13H2,1-2H3,(H,21,22) |
| InChIKey | SFVFIYXMRRVITD-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.45 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |