C14H14BrN3O — CID 110862839
N-(2-bromophenyl)-2,4,6-trimethylpyrimidine-5-carboxamide (PubChem CID 110862839) has the molecular formula C14H14BrN3O and a molecular weight of 320.19 g/mol. Its IUPAC name is N-(2-bromophenyl)-2,4,6-trimethylpyrimidine-5-carboxamide.
| Compound Name | N-(2-bromophenyl)-2,4,6-trimethylpyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 110862839 |
| Molecular Formula | C14H14BrN3O |
| Molecular Weight | 320.19 g/mol |
| Exact Mass | 319.03 |
| IUPAC Name | N-(2-bromophenyl)-2,4,6-trimethylpyrimidine-5-carboxamide |
| SMILES | Cc1nc(C)c(C(=O)Nc2ccccc2Br)c(C)n1 |
| InChI | InChI=1S/C14H14BrN3O/c1-8-13(9(2)17-10(3)16-8)14(19)18-12-7-5-4-6-11(12)15/h4-7H,1-3H3,(H,18,19) |
| InChIKey | VZSZBIYWFIPMPG-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.19 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |