C13H9BrClF3N2O — CID 43411079
4-bromo-N-[4-chloro-2-(trifluoromethyl)phenyl]-1-methylpyrrole-2-carboxamide (PubChem CID 43411079) has the molecular formula C13H9BrClF3N2O and a molecular weight of 381.58 g/mol. Its IUPAC name is 4-bromo-N-[4-chloro-2-(trifluoromethyl)phenyl]-1-methylpyrrole-2-carboxamide.
| Compound Name | 4-bromo-N-[4-chloro-2-(trifluoromethyl)phenyl]-1-methylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 43411079 |
| Molecular Formula | C13H9BrClF3N2O |
| Molecular Weight | 381.58 g/mol |
| Exact Mass | 379.95 |
| IUPAC Name | 4-bromo-N-[4-chloro-2-(trifluoromethyl)phenyl]-1-methylpyrrole-2-carboxamide |
| SMILES | Cn1cc(Br)cc1C(=O)Nc1ccc(Cl)cc1C(F)(F)F |
| InChI | InChI=1S/C13H9BrClF3N2O/c1-20-6-7(14)4-11(20)12(21)19-10-3-2-8(15)5-9(10)13(16,17)18/h2-6H,1H3,(H,19,21) |
| InChIKey | FZQNOWWNKIDISG-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.58 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |