C12H8Br2F2N2O — CID 103842486
4-bromo-N-(4-bromo-2,5-difluorophenyl)-1-methylpyrrole-2-carboxamide (PubChem CID 103842486) has the molecular formula C12H8Br2F2N2O and a molecular weight of 394.01 g/mol. Its IUPAC name is 4-bromo-N-(4-bromo-2,5-difluorophenyl)-1-methylpyrrole-2-carboxamide.
| Compound Name | 4-bromo-N-(4-bromo-2,5-difluorophenyl)-1-methylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 103842486 |
| Molecular Formula | C12H8Br2F2N2O |
| Molecular Weight | 394.01 g/mol |
| Exact Mass | 391.90 |
| IUPAC Name | 4-bromo-N-(4-bromo-2,5-difluorophenyl)-1-methylpyrrole-2-carboxamide |
| SMILES | Cn1cc(Br)cc1C(=O)Nc1cc(F)c(Br)cc1F |
| InChI | InChI=1S/C12H8Br2F2N2O/c1-18-5-6(13)2-11(18)12(19)17-10-4-8(15)7(14)3-9(10)16/h2-5H,1H3,(H,17,19) |
| InChIKey | PDXQNGICCJIJSA-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.01 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|