C12H9BrClFN2O — CID 43411034
4-bromo-N-(3-chloro-2-fluorophenyl)-1-methylpyrrole-2-carboxamide (PubChem CID 43411034) has the molecular formula C12H9BrClFN2O and a molecular weight of 331.57 g/mol. Its IUPAC name is 4-bromo-N-(3-chloro-2-fluorophenyl)-1-methylpyrrole-2-carboxamide.
| Compound Name | 4-bromo-N-(3-chloro-2-fluorophenyl)-1-methylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 43411034 |
| Molecular Formula | C12H9BrClFN2O |
| Molecular Weight | 331.57 g/mol |
| Exact Mass | 329.96 |
| IUPAC Name | 4-bromo-N-(3-chloro-2-fluorophenyl)-1-methylpyrrole-2-carboxamide |
| SMILES | Cn1cc(Br)cc1C(=O)Nc1cccc(Cl)c1F |
| InChI | InChI=1S/C12H9BrClFN2O/c1-17-6-7(13)5-10(17)12(18)16-9-4-2-3-8(14)11(9)15/h2-6H,1H3,(H,16,18) |
| InChIKey | INDBBBRAOGHXRR-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.57 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |