C13H13BrN2O2 — CID 60954936
4-bromo-N-[2-(hydroxymethyl)phenyl]-1-methylpyrrole-2-carboxamide (PubChem CID 60954936) has the molecular formula C13H13BrN2O2 and a molecular weight of 309.16 g/mol. Its IUPAC name is 4-bromo-N-[2-(hydroxymethyl)phenyl]-1-methylpyrrole-2-carboxamide.
| Compound Name | 4-bromo-N-[2-(hydroxymethyl)phenyl]-1-methylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 60954936 |
| Molecular Formula | C13H13BrN2O2 |
| Molecular Weight | 309.16 g/mol |
| Exact Mass | 308.02 |
| IUPAC Name | 4-bromo-N-[2-(hydroxymethyl)phenyl]-1-methylpyrrole-2-carboxamide |
| SMILES | Cn1cc(Br)cc1C(=O)Nc1ccccc1CO |
| InChI | InChI=1S/C13H13BrN2O2/c1-16-7-10(14)6-12(16)13(18)15-11-5-3-2-4-9(11)8-17/h2-7,17H,8H2,1H3,(H,15,18) |
| InChIKey | ISWRTAYTAASVPQ-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 54.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.16 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |