C16H21BrClN3O — CID 119438837
4-bromo-1-ethyl-N-[2-(ethylaminomethyl)phenyl]pyrrole-2-carboxamide;hydrochloride (PubChem CID 119438837) has the molecular formula C16H21BrClN3O and a molecular weight of 386.72 g/mol. Its IUPAC name is 4-bromo-1-ethyl-N-[2-(ethylaminomethyl)phenyl]pyrrole-2-carboxamide;hydrochloride.
| Compound Name | 4-bromo-1-ethyl-N-[2-(ethylaminomethyl)phenyl]pyrrole-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119438837 |
| Molecular Formula | C16H21BrClN3O |
| Molecular Weight | 386.72 g/mol |
| Exact Mass | 385.06 |
| IUPAC Name | 4-bromo-1-ethyl-N-[2-(ethylaminomethyl)phenyl]pyrrole-2-carboxamide;hydrochloride |
| SMILES | CCNCc1ccccc1NC(=O)c1cc(Br)cn1CC.Cl |
| InChI | InChI=1S/C16H20BrN3O.ClH/c1-3-18-10-12-7-5-6-8-14(12)19-16(21)15-9-13(17)11-20(15)4-2;/h5-9,11,18H,3-4,10H2,1-2H3,(H,19,21);1H |
| InChIKey | FZXDTJCYXQPCEP-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 46.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.72 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |