C14H12BrFN2O3 — CID 43639581
2-[(4-bromo-1-ethylpyrrole-2-carbonyl)amino]-6-fluorobenzoic acid (PubChem CID 43639581) has the molecular formula C14H12BrFN2O3 and a molecular weight of 355.16 g/mol. Its IUPAC name is 2-[(4-bromo-1-ethylpyrrole-2-carbonyl)amino]-6-fluorobenzoic acid.
| Compound Name | 2-[(4-bromo-1-ethylpyrrole-2-carbonyl)amino]-6-fluorobenzoic acid |
|---|---|
| PubChem CID | 43639581 |
| Molecular Formula | C14H12BrFN2O3 |
| Molecular Weight | 355.16 g/mol |
| Exact Mass | 354.00 |
| IUPAC Name | 2-[(4-bromo-1-ethylpyrrole-2-carbonyl)amino]-6-fluorobenzoic acid |
| SMILES | CCn1cc(Br)cc1C(=O)Nc1cccc(F)c1C(=O)O |
| InChI | InChI=1S/C14H12BrFN2O3/c1-2-18-7-8(15)6-11(18)13(19)17-10-5-3-4-9(16)12(10)14(20)21/h3-7H,2H2,1H3,(H,17,19)(H,20,21) |
| InChIKey | KBQIFOYOMAFGLW-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 71.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.16 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |