C13H11Br2FN2O — CID 103753374
4-bromo-N-(2-bromo-5-fluorophenyl)-1-ethylpyrrole-2-carboxamide (PubChem CID 103753374) has the molecular formula C13H11Br2FN2O and a molecular weight of 390.05 g/mol. Its IUPAC name is 4-bromo-N-(2-bromo-5-fluorophenyl)-1-ethylpyrrole-2-carboxamide.
| Compound Name | 4-bromo-N-(2-bromo-5-fluorophenyl)-1-ethylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 103753374 |
| Molecular Formula | C13H11Br2FN2O |
| Molecular Weight | 390.05 g/mol |
| Exact Mass | 387.92 |
| IUPAC Name | 4-bromo-N-(2-bromo-5-fluorophenyl)-1-ethylpyrrole-2-carboxamide |
| SMILES | CCn1cc(Br)cc1C(=O)Nc1cc(F)ccc1Br |
| InChI | InChI=1S/C13H11Br2FN2O/c1-2-18-7-8(14)5-12(18)13(19)17-11-6-9(16)3-4-10(11)15/h3-7H,2H2,1H3,(H,17,19) |
| InChIKey | UWMOFTSTPKNYJS-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.05 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |