C14H13BrFN3O2 — CID 60728721
N-(5-acetamido-2-fluorophenyl)-4-bromo-1-methylpyrrole-2-carboxamide (PubChem CID 60728721) has the molecular formula C14H13BrFN3O2 and a molecular weight of 354.18 g/mol. Its IUPAC name is N-(5-acetamido-2-fluorophenyl)-4-bromo-1-methylpyrrole-2-carboxamide.
| Compound Name | N-(5-acetamido-2-fluorophenyl)-4-bromo-1-methylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 60728721 |
| Molecular Formula | C14H13BrFN3O2 |
| Molecular Weight | 354.18 g/mol |
| Exact Mass | 353.02 |
| IUPAC Name | N-(5-acetamido-2-fluorophenyl)-4-bromo-1-methylpyrrole-2-carboxamide |
| SMILES | CC(=O)Nc1ccc(F)c(NC(=O)c2cc(Br)cn2C)c1 |
| InChI | InChI=1S/C14H13BrFN3O2/c1-8(20)17-10-3-4-11(16)12(6-10)18-14(21)13-5-9(15)7-19(13)2/h3-7H,1-2H3,(H,17,20)(H,18,21) |
| InChIKey | WGFAXLVCGFDADF-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 63.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.18 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |