C14H12Br2F2N2O — CID 102853993
4-bromo-N-(5-bromo-2,4-difluorophenyl)-1-propan-2-ylpyrrole-2-carboxamide (PubChem CID 102853993) has the molecular formula C14H12Br2F2N2O and a molecular weight of 422.07 g/mol. Its IUPAC name is 4-bromo-N-(5-bromo-2,4-difluorophenyl)-1-propan-2-ylpyrrole-2-carboxamide.
| Compound Name | 4-bromo-N-(5-bromo-2,4-difluorophenyl)-1-propan-2-ylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 102853993 |
| Molecular Formula | C14H12Br2F2N2O |
| Molecular Weight | 422.07 g/mol |
| Exact Mass | 419.93 |
| IUPAC Name | 4-bromo-N-(5-bromo-2,4-difluorophenyl)-1-propan-2-ylpyrrole-2-carboxamide |
| SMILES | CC(C)n1cc(Br)cc1C(=O)Nc1cc(Br)c(F)cc1F |
| InChI | InChI=1S/C14H12Br2F2N2O/c1-7(2)20-6-8(15)3-13(20)14(21)19-12-4-9(16)10(17)5-11(12)18/h3-7H,1-2H3,(H,19,21) |
| InChIKey | WAGXZFZKDVMDIY-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.07 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|