C15H16BrFN2O2 — CID 114839980
4-bromo-N-(4-fluoro-3-methoxyphenyl)-1-propan-2-ylpyrrole-2-carboxamide (PubChem CID 114839980) has the molecular formula C15H16BrFN2O2 and a molecular weight of 355.21 g/mol. Its IUPAC name is 4-bromo-N-(4-fluoro-3-methoxyphenyl)-1-propan-2-ylpyrrole-2-carboxamide.
| Compound Name | 4-bromo-N-(4-fluoro-3-methoxyphenyl)-1-propan-2-ylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 114839980 |
| Molecular Formula | C15H16BrFN2O2 |
| Molecular Weight | 355.21 g/mol |
| Exact Mass | 354.04 |
| IUPAC Name | 4-bromo-N-(4-fluoro-3-methoxyphenyl)-1-propan-2-ylpyrrole-2-carboxamide |
| SMILES | COc1cc(NC(=O)c2cc(Br)cn2C(C)C)ccc1F |
| InChI | InChI=1S/C15H16BrFN2O2/c1-9(2)19-8-10(16)6-13(19)15(20)18-11-4-5-12(17)14(7-11)21-3/h4-9H,1-3H3,(H,18,20) |
| InChIKey | JFIPMZGKGVFVAM-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 43.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.21 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |