C18H27N3O4S3 — CID 24580768
N-[5-(diethylsulfamoyl)-2-(propylamino)phenyl]-5-methylthiophene-2-sulfonamide (PubChem CID 24580768) has the molecular formula C18H27N3O4S3 and a molecular weight of 445.63 g/mol. Its IUPAC name is N-[5-(diethylsulfamoyl)-2-(propylamino)phenyl]-5-methylthiophene-2-sulfonamide.
| Compound Name | N-[5-(diethylsulfamoyl)-2-(propylamino)phenyl]-5-methylthiophene-2-sulfonamide |
|---|---|
| PubChem CID | 24580768 |
| Molecular Formula | C18H27N3O4S3 |
| Molecular Weight | 445.63 g/mol |
| Exact Mass | 445.12 |
| IUPAC Name | N-[5-(diethylsulfamoyl)-2-(propylamino)phenyl]-5-methylthiophene-2-sulfonamide |
| SMILES | CCCNc1ccc(S(=O)(=O)N(CC)CC)cc1NS(=O)(=O)c1ccc(C)s1 |
| InChI | InChI=1S/C18H27N3O4S3/c1-5-12-19-16-10-9-15(28(24,25)21(6-2)7-3)13-17(16)20-27(22,23)18-11-8-14(4)26-18/h8-11,13,19-20H,5-7,12H2,1-4H3 |
| InChIKey | RKPHAJYLSGOPIX-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.63 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |