C19H25F2N3O4S2 — CID 24580769
N-[5-(diethylsulfamoyl)-2-(propylamino)phenyl]-2,5-difluorobenzenesulfonamide (PubChem CID 24580769) has the molecular formula C19H25F2N3O4S2 and a molecular weight of 461.56 g/mol. Its IUPAC name is N-[5-(diethylsulfamoyl)-2-(propylamino)phenyl]-2,5-difluorobenzenesulfonamide.
| Compound Name | N-[5-(diethylsulfamoyl)-2-(propylamino)phenyl]-2,5-difluorobenzenesulfonamide |
|---|---|
| PubChem CID | 24580769 |
| Molecular Formula | C19H25F2N3O4S2 |
| Molecular Weight | 461.56 g/mol |
| Exact Mass | 461.13 |
| IUPAC Name | N-[5-(diethylsulfamoyl)-2-(propylamino)phenyl]-2,5-difluorobenzenesulfonamide |
| SMILES | CCCNc1ccc(S(=O)(=O)N(CC)CC)cc1NS(=O)(=O)c1cc(F)ccc1F |
| InChI | InChI=1S/C19H25F2N3O4S2/c1-4-11-22-17-10-8-15(30(27,28)24(5-2)6-3)13-18(17)23-29(25,26)19-12-14(20)7-9-16(19)21/h7-10,12-13,22-23H,4-6,11H2,1-3H3 |
| InChIKey | VNFXBUAXNCZSIR-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.56 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |