C17H21FN2O4S2 — CID 2681633
4-N,4-N-diethyl-1-N-(4-fluoro-2-methylphenyl)benzene-1,4-disulfonamide (PubChem CID 2681633) has the molecular formula C17H21FN2O4S2 and a molecular weight of 400.50 g/mol. Its IUPAC name is 4-N,4-N-diethyl-1-N-(4-fluoro-2-methylphenyl)benzene-1,4-disulfonamide.
| Compound Name | 4-N,4-N-diethyl-1-N-(4-fluoro-2-methylphenyl)benzene-1,4-disulfonamide |
|---|---|
| PubChem CID | 2681633 |
| Molecular Formula | C17H21FN2O4S2 |
| Molecular Weight | 400.50 g/mol |
| Exact Mass | 400.09 |
| IUPAC Name | 4-N,4-N-diethyl-1-N-(4-fluoro-2-methylphenyl)benzene-1,4-disulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(S(=O)(=O)Nc2ccc(F)cc2C)cc1 |
| InChI | InChI=1S/C17H21FN2O4S2/c1-4-20(5-2)26(23,24)16-9-7-15(8-10-16)25(21,22)19-17-11-6-14(18)12-13(17)3/h6-12,19H,4-5H2,1-3H3 |
| InChIKey | ONZHTNFPYOZOCJ-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.50 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |