C17H21ClN2O4S2 — CID 2681540
1-N-(4-chloro-2-methylphenyl)-4-N,4-N-diethylbenzene-1,4-disulfonamide (PubChem CID 2681540) has the molecular formula C17H21ClN2O4S2 and a molecular weight of 416.95 g/mol. Its IUPAC name is 1-N-(4-chloro-2-methylphenyl)-4-N,4-N-diethylbenzene-1,4-disulfonamide.
| Compound Name | 1-N-(4-chloro-2-methylphenyl)-4-N,4-N-diethylbenzene-1,4-disulfonamide |
|---|---|
| PubChem CID | 2681540 |
| Molecular Formula | C17H21ClN2O4S2 |
| Molecular Weight | 416.95 g/mol |
| Exact Mass | 416.06 |
| IUPAC Name | 1-N-(4-chloro-2-methylphenyl)-4-N,4-N-diethylbenzene-1,4-disulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(S(=O)(=O)Nc2ccc(Cl)cc2C)cc1 |
| InChI | InChI=1S/C17H21ClN2O4S2/c1-4-20(5-2)26(23,24)16-9-7-15(8-10-16)25(21,22)19-17-11-6-14(18)12-13(17)3/h6-12,19H,4-5H2,1-3H3 |
| InChIKey | FYECGDASHJDALQ-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.95 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |