C21H29N5O4S — CID 24510878
4-[[2-[5-(diethylsulfamoyl)-2-(ethylamino)anilino]acetyl]amino]benzamide (PubChem CID 24510878) has the molecular formula C21H29N5O4S and a molecular weight of 447.56 g/mol. Its IUPAC name is 4-[[2-[5-(diethylsulfamoyl)-2-(ethylamino)anilino]acetyl]amino]benzamide.
| Compound Name | 4-[[2-[5-(diethylsulfamoyl)-2-(ethylamino)anilino]acetyl]amino]benzamide |
|---|---|
| PubChem CID | 24510878 |
| Molecular Formula | C21H29N5O4S |
| Molecular Weight | 447.56 g/mol |
| Exact Mass | 447.19 |
| IUPAC Name | 4-[[2-[5-(diethylsulfamoyl)-2-(ethylamino)anilino]acetyl]amino]benzamide |
| SMILES | CCNc1ccc(S(=O)(=O)N(CC)CC)cc1NCC(=O)Nc1ccc(C(N)=O)cc1 |
| InChI | InChI=1S/C21H29N5O4S/c1-4-23-18-12-11-17(31(29,30)26(5-2)6-3)13-19(18)24-14-20(27)25-16-9-7-15(8-10-16)21(22)28/h7-13,23-24H,4-6,14H2,1-3H3,(H2,22,28)(H,25,27) |
| InChIKey | BCEXMERHJXEILK-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 133.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.56 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |